C12H20F3IN6 — CID 111778308
2-(6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-3-ylmethyl)-1-ethyl-3-(3,3,3-trifluoropropyl)guanidine;hydroiodide (PubChem CID 111778308) has the molecular formula C12H20F3IN6 and a molecular weight of 432.23 g/mol. Its IUPAC name is 2-(6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-3-ylmethyl)-1-ethyl-3-(3,3,3-trifluoropropyl)guanidine;hydroiodide.
| Compound Name | 2-(6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-3-ylmethyl)-1-ethyl-3-(3,3,3-trifluoropropyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111778308 |
| Molecular Formula | C12H20F3IN6 |
| Molecular Weight | 432.23 g/mol |
| Exact Mass | 432.07 |
| IUPAC Name | 2-(6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-3-ylmethyl)-1-ethyl-3-(3,3,3-trifluoropropyl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1nnc2n1CCC2)NCCC(F)(F)F.I |
| InChI | InChI=1S/C12H19F3N6.HI/c1-2-16-11(17-6-5-12(13,14)15)18-8-10-20-19-9-4-3-7-21(9)10;/h2-8H2,1H3,(H2,16,17,18);1H |
| InChIKey | BRSWHOYVDAXELQ-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 67.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.23 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|