C23H35IN6 — CID 111852465
1-ethyl-3-[(1-phenylcyclopentyl)methyl]-2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylmethyl)guanidine;hydroiodide (PubChem CID 111852465) has the molecular formula C23H35IN6 and a molecular weight of 522.48 g/mol. Its IUPAC name is 1-ethyl-3-[(1-phenylcyclopentyl)methyl]-2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylmethyl)guanidine;hydroiodide.
| Compound Name | 1-ethyl-3-[(1-phenylcyclopentyl)methyl]-2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylmethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111852465 |
| Molecular Formula | C23H35IN6 |
| Molecular Weight | 522.48 g/mol |
| Exact Mass | 522.20 |
| IUPAC Name | 1-ethyl-3-[(1-phenylcyclopentyl)methyl]-2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylmethyl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1nnc2n1CCCCC2)NCC1(c2ccccc2)CCCC1.I |
| InChI | InChI=1S/C23H34N6.HI/c1-2-24-22(25-17-21-28-27-20-13-7-4-10-16-29(20)21)26-18-23(14-8-9-15-23)19-11-5-3-6-12-19;/h3,5-6,11-12H,2,4,7-10,13-18H2,1H3,(H2,24,25,26);1H |
| InChIKey | XCGGSIULTCKWGY-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 67.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.48 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|