C23H37N7 — CID 111011139
1-[2-(diethylamino)-2-phenylethyl]-3-ethyl-2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylmethyl)guanidine (PubChem CID 111011139) has the molecular formula C23H37N7 and a molecular weight of 411.60 g/mol. Its IUPAC name is 1-[2-(diethylamino)-2-phenylethyl]-3-ethyl-2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylmethyl)guanidine.
| Compound Name | 1-[2-(diethylamino)-2-phenylethyl]-3-ethyl-2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylmethyl)guanidine |
|---|---|
| PubChem CID | 111011139 |
| Molecular Formula | C23H37N7 |
| Molecular Weight | 411.60 g/mol |
| Exact Mass | 411.31 |
| IUPAC Name | 1-[2-(diethylamino)-2-phenylethyl]-3-ethyl-2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylmethyl)guanidine |
| SMILES | CCN/C(=N\Cc1nnc2n1CCCCC2)NCC(c1ccccc1)N(CC)CC |
| InChI | InChI=1S/C23H37N7/c1-4-24-23(26-18-22-28-27-21-15-11-8-12-16-30(21)22)25-17-20(29(5-2)6-3)19-13-9-7-10-14-19/h7,9-10,13-14,20H,4-6,8,11-12,15-18H2,1-3H3,(H2,24,25,26) |
| InChIKey | YTBIJEPOSPXEPN-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 70.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.60 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|