C23H28N6 — CID 111020449
2-(6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-3-ylmethyl)-1-(2,2-diphenylethyl)-3-ethylguanidine (PubChem CID 111020449) has the molecular formula C23H28N6 and a molecular weight of 388.52 g/mol. Its IUPAC name is 2-(6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-3-ylmethyl)-1-(2,2-diphenylethyl)-3-ethylguanidine.
| Compound Name | 2-(6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-3-ylmethyl)-1-(2,2-diphenylethyl)-3-ethylguanidine |
|---|---|
| PubChem CID | 111020449 |
| Molecular Formula | C23H28N6 |
| Molecular Weight | 388.52 g/mol |
| Exact Mass | 388.24 |
| IUPAC Name | 2-(6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-3-ylmethyl)-1-(2,2-diphenylethyl)-3-ethylguanidine |
| SMILES | CCN/C(=N\Cc1nnc2n1CCC2)NCC(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C23H28N6/c1-2-24-23(26-17-22-28-27-21-14-9-15-29(21)22)25-16-20(18-10-5-3-6-11-18)19-12-7-4-8-13-19/h3-8,10-13,20H,2,9,14-17H2,1H3,(H2,24,25,26) |
| InChIKey | UGDMEVBGTFGBEG-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 67.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.52 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|