C22H34IN7O — CID 111020392
2-(6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-3-ylmethyl)-1-ethyl-3-[2-(2-methoxyphenyl)-2-pyrrolidin-1-ylethyl]guanidine;hydroiodide (PubChem CID 111020392) has the molecular formula C22H34IN7O and a molecular weight of 539.47 g/mol. Its IUPAC name is 2-(6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-3-ylmethyl)-1-ethyl-3-[2-(2-methoxyphenyl)-2-pyrrolidin-1-ylethyl]guanidine;hydroiodide.
| Compound Name | 2-(6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-3-ylmethyl)-1-ethyl-3-[2-(2-methoxyphenyl)-2-pyrrolidin-1-ylethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111020392 |
| Molecular Formula | C22H34IN7O |
| Molecular Weight | 539.47 g/mol |
| Exact Mass | 539.19 |
| IUPAC Name | 2-(6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-3-ylmethyl)-1-ethyl-3-[2-(2-methoxyphenyl)-2-pyrrolidin-1-ylethyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1nnc2n1CCC2)NCC(c1ccccc1OC)N1CCCC1.I |
| InChI | InChI=1S/C22H33N7O.HI/c1-3-23-22(25-16-21-27-26-20-11-8-14-29(20)21)24-15-18(28-12-6-7-13-28)17-9-4-5-10-19(17)30-2;/h4-5,9-10,18H,3,6-8,11-16H2,1-2H3,(H2,23,24,25);1H |
| InChIKey | CASURJUZTBDAAM-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 79.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.47 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|