C15H22ClIN6OS — CID 111501862
1-[2-(5-chlorothiophen-2-yl)-2-hydroxyethyl]-2-(6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-3-ylmethyl)-3-ethylguanidine;hydroiodide (PubChem CID 111501862) has the molecular formula C15H22ClIN6OS and a molecular weight of 496.81 g/mol. Its IUPAC name is 1-[2-(5-chlorothiophen-2-yl)-2-hydroxyethyl]-2-(6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-3-ylmethyl)-3-ethylguanidine;hydroiodide.
| Compound Name | 1-[2-(5-chlorothiophen-2-yl)-2-hydroxyethyl]-2-(6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-3-ylmethyl)-3-ethylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111501862 |
| Molecular Formula | C15H22ClIN6OS |
| Molecular Weight | 496.81 g/mol |
| Exact Mass | 496.03 |
| IUPAC Name | 1-[2-(5-chlorothiophen-2-yl)-2-hydroxyethyl]-2-(6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-3-ylmethyl)-3-ethylguanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1nnc2n1CCC2)NCC(O)c1ccc(Cl)s1.I |
| InChI | InChI=1S/C15H21ClN6OS.HI/c1-2-17-15(18-8-10(23)11-5-6-12(16)24-11)19-9-14-21-20-13-4-3-7-22(13)14;/h5-6,10,23H,2-4,7-9H2,1H3,(H2,17,18,19);1H |
| InChIKey | BRISEYWWQUZPSG-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 87.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.81 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|