C15H21F3IN7S — CID 111617616
1-ethyl-2-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)-3-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]methyl]guanidine;hydroiodide (PubChem CID 111617616) has the molecular formula C15H21F3IN7S and a molecular weight of 515.35 g/mol. Its IUPAC name is 1-ethyl-2-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)-3-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]methyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-2-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)-3-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111617616 |
| Molecular Formula | C15H21F3IN7S |
| Molecular Weight | 515.35 g/mol |
| Exact Mass | 515.06 |
| IUPAC Name | 1-ethyl-2-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)-3-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1nnc2n1CCCC2)NCc1nc(C(F)(F)F)cs1.I |
| InChI | InChI=1S/C15H20F3N7S.HI/c1-2-19-14(21-8-13-22-10(9-26-13)15(16,17)18)20-7-12-24-23-11-5-3-4-6-25(11)12;/h9H,2-8H2,1H3,(H2,19,20,21);1H |
| InChIKey | JYVJRPXERVCVGN-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 80.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.35 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|