C18H27F3IN7S — CID 111688997
2-methyl-1-[3-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)propyl]-3-[2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]ethyl]guanidine;hydroiodide (PubChem CID 111688997) has the molecular formula C18H27F3IN7S and a molecular weight of 557.43 g/mol. Its IUPAC name is 2-methyl-1-[3-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)propyl]-3-[2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]ethyl]guanidine;hydroiodide.
| Compound Name | 2-methyl-1-[3-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)propyl]-3-[2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111688997 |
| Molecular Formula | C18H27F3IN7S |
| Molecular Weight | 557.43 g/mol |
| Exact Mass | 557.10 |
| IUPAC Name | 2-methyl-1-[3-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)propyl]-3-[2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]ethyl]guanidine;hydroiodide |
| SMILES | C/N=C(/NCCCc1nnc2n1CCCCC2)NCCc1nc(C(F)(F)F)cs1.I |
| InChI | InChI=1S/C18H26F3N7S.HI/c1-22-17(24-10-8-16-25-13(12-29-16)18(19,20)21)23-9-5-7-15-27-26-14-6-3-2-4-11-28(14)15;/h12H,2-11H2,1H3,(H2,22,23,24);1H |
| InChIKey | VPUUOXRPBORKLF-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 80.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.43 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|