C15H16F4N4S — CID 111617776
1-ethyl-2-[(4-fluorophenyl)methyl]-3-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]methyl]guanidine (PubChem CID 111617776) has the molecular formula C15H16F4N4S and a molecular weight of 360.38 g/mol. Its IUPAC name is 1-ethyl-2-[(4-fluorophenyl)methyl]-3-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]methyl]guanidine.
| Compound Name | 1-ethyl-2-[(4-fluorophenyl)methyl]-3-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]methyl]guanidine |
|---|---|
| PubChem CID | 111617776 |
| Molecular Formula | C15H16F4N4S |
| Molecular Weight | 360.38 g/mol |
| Exact Mass | 360.10 |
| IUPAC Name | 1-ethyl-2-[(4-fluorophenyl)methyl]-3-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]methyl]guanidine |
| SMILES | CCN/C(=N\Cc1ccc(F)cc1)NCc1nc(C(F)(F)F)cs1 |
| InChI | InChI=1S/C15H16F4N4S/c1-2-20-14(21-7-10-3-5-11(16)6-4-10)22-8-13-23-12(9-24-13)15(17,18)19/h3-6,9H,2,7-8H2,1H3,(H2,20,21,22) |
| InChIKey | GTLQZHFENPBGPB-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 49.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.38 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|