C19H28N4OS — CID 111835703
1-[(4-tert-butyl-1,3-thiazol-2-yl)methyl]-3-ethyl-2-[(4-methoxyphenyl)methyl]guanidine (PubChem CID 111835703) has the molecular formula C19H28N4OS and a molecular weight of 360.53 g/mol. Its IUPAC name is 1-[(4-tert-butyl-1,3-thiazol-2-yl)methyl]-3-ethyl-2-[(4-methoxyphenyl)methyl]guanidine.
| Compound Name | 1-[(4-tert-butyl-1,3-thiazol-2-yl)methyl]-3-ethyl-2-[(4-methoxyphenyl)methyl]guanidine |
|---|---|
| PubChem CID | 111835703 |
| Molecular Formula | C19H28N4OS |
| Molecular Weight | 360.53 g/mol |
| Exact Mass | 360.20 |
| IUPAC Name | 1-[(4-tert-butyl-1,3-thiazol-2-yl)methyl]-3-ethyl-2-[(4-methoxyphenyl)methyl]guanidine |
| SMILES | CCN/C(=N\Cc1ccc(OC)cc1)NCc1nc(C(C)(C)C)cs1 |
| InChI | InChI=1S/C19H28N4OS/c1-6-20-18(21-11-14-7-9-15(24-5)10-8-14)22-12-17-23-16(13-25-17)19(2,3)4/h7-10,13H,6,11-12H2,1-5H3,(H2,20,21,22) |
| InChIKey | KODZRCIXGICZCF-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 58.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.53 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|