C21H22F3N5OS — CID 111615114
1-ethyl-2-[[4-(pyridin-2-ylmethoxy)phenyl]methyl]-3-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]methyl]guanidine (PubChem CID 111615114) has the molecular formula C21H22F3N5OS and a molecular weight of 449.50 g/mol. Its IUPAC name is 1-ethyl-2-[[4-(pyridin-2-ylmethoxy)phenyl]methyl]-3-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]methyl]guanidine.
| Compound Name | 1-ethyl-2-[[4-(pyridin-2-ylmethoxy)phenyl]methyl]-3-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]methyl]guanidine |
|---|---|
| PubChem CID | 111615114 |
| Molecular Formula | C21H22F3N5OS |
| Molecular Weight | 449.50 g/mol |
| Exact Mass | 449.15 |
| IUPAC Name | 1-ethyl-2-[[4-(pyridin-2-ylmethoxy)phenyl]methyl]-3-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]methyl]guanidine |
| SMILES | CCN/C(=N\Cc1ccc(OCc2ccccn2)cc1)NCc1nc(C(F)(F)F)cs1 |
| InChI | InChI=1S/C21H22F3N5OS/c1-2-25-20(28-12-19-29-18(14-31-19)21(22,23)24)27-11-15-6-8-17(9-7-15)30-13-16-5-3-4-10-26-16/h3-10,14H,2,11-13H2,1H3,(H2,25,27,28) |
| InChIKey | NPSHSLNPKBDPFG-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 71.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.50 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|