C16H16F6N4OS — CID 111616682
1-ethyl-2-[[2-(trifluoromethoxy)phenyl]methyl]-3-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]methyl]guanidine (PubChem CID 111616682) has the molecular formula C16H16F6N4OS and a molecular weight of 426.39 g/mol. Its IUPAC name is 1-ethyl-2-[[2-(trifluoromethoxy)phenyl]methyl]-3-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]methyl]guanidine.
| Compound Name | 1-ethyl-2-[[2-(trifluoromethoxy)phenyl]methyl]-3-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]methyl]guanidine |
|---|---|
| PubChem CID | 111616682 |
| Molecular Formula | C16H16F6N4OS |
| Molecular Weight | 426.39 g/mol |
| Exact Mass | 426.09 |
| IUPAC Name | 1-ethyl-2-[[2-(trifluoromethoxy)phenyl]methyl]-3-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]methyl]guanidine |
| SMILES | CCN/C(=N\Cc1ccccc1OC(F)(F)F)NCc1nc(C(F)(F)F)cs1 |
| InChI | InChI=1S/C16H16F6N4OS/c1-2-23-14(25-8-13-26-12(9-28-13)15(17,18)19)24-7-10-5-3-4-6-11(10)27-16(20,21)22/h3-6,9H,2,7-8H2,1H3,(H2,23,24,25) |
| InChIKey | AGRKROANLUEOEX-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 58.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.39 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|