C16H15F4N5S — CID 111987119
2-[(5-cyano-2-fluorophenyl)methyl]-1-ethyl-3-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]methyl]guanidine (PubChem CID 111987119) has the molecular formula C16H15F4N5S and a molecular weight of 385.39 g/mol. Its IUPAC name is 2-[(5-cyano-2-fluorophenyl)methyl]-1-ethyl-3-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]methyl]guanidine.
| Compound Name | 2-[(5-cyano-2-fluorophenyl)methyl]-1-ethyl-3-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]methyl]guanidine |
|---|---|
| PubChem CID | 111987119 |
| Molecular Formula | C16H15F4N5S |
| Molecular Weight | 385.39 g/mol |
| Exact Mass | 385.10 |
| IUPAC Name | 2-[(5-cyano-2-fluorophenyl)methyl]-1-ethyl-3-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]methyl]guanidine |
| SMILES | CCN/C(=N\Cc1cc(C#N)ccc1F)NCc1nc(C(F)(F)F)cs1 |
| InChI | InChI=1S/C16H15F4N5S/c1-2-22-15(23-7-11-5-10(6-21)3-4-12(11)17)24-8-14-25-13(9-26-14)16(18,19)20/h3-5,9H,2,7-8H2,1H3,(H2,22,23,24) |
| InChIKey | WMIDESMSALGYJJ-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 73.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.39 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|