C17H21FIN5S — CID 111985410
2-[(5-cyano-2-fluorophenyl)methyl]-1-ethyl-3-[(5-ethyl-1,3-thiazol-2-yl)methyl]guanidine;hydroiodide (PubChem CID 111985410) has the molecular formula C17H21FIN5S and a molecular weight of 473.36 g/mol. Its IUPAC name is 2-[(5-cyano-2-fluorophenyl)methyl]-1-ethyl-3-[(5-ethyl-1,3-thiazol-2-yl)methyl]guanidine;hydroiodide.
| Compound Name | 2-[(5-cyano-2-fluorophenyl)methyl]-1-ethyl-3-[(5-ethyl-1,3-thiazol-2-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111985410 |
| Molecular Formula | C17H21FIN5S |
| Molecular Weight | 473.36 g/mol |
| Exact Mass | 473.05 |
| IUPAC Name | 2-[(5-cyano-2-fluorophenyl)methyl]-1-ethyl-3-[(5-ethyl-1,3-thiazol-2-yl)methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1cc(C#N)ccc1F)NCc1ncc(CC)s1.I |
| InChI | InChI=1S/C17H20FN5S.HI/c1-3-14-10-21-16(24-14)11-23-17(20-4-2)22-9-13-7-12(8-19)5-6-15(13)18;/h5-7,10H,3-4,9,11H2,1-2H3,(H2,20,22,23);1H |
| InChIKey | VMPKZRWAJCDWBQ-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 73.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.36 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|