C18H26BrIN4O2S — CID 111534413
2-[(2-bromo-4,5-dimethoxyphenyl)methyl]-1-ethyl-3-[(5-ethyl-1,3-thiazol-2-yl)methyl]guanidine;hydroiodide (PubChem CID 111534413) has the molecular formula C18H26BrIN4O2S and a molecular weight of 569.31 g/mol. Its IUPAC name is 2-[(2-bromo-4,5-dimethoxyphenyl)methyl]-1-ethyl-3-[(5-ethyl-1,3-thiazol-2-yl)methyl]guanidine;hydroiodide.
| Compound Name | 2-[(2-bromo-4,5-dimethoxyphenyl)methyl]-1-ethyl-3-[(5-ethyl-1,3-thiazol-2-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111534413 |
| Molecular Formula | C18H26BrIN4O2S |
| Molecular Weight | 569.31 g/mol |
| Exact Mass | 568.00 |
| IUPAC Name | 2-[(2-bromo-4,5-dimethoxyphenyl)methyl]-1-ethyl-3-[(5-ethyl-1,3-thiazol-2-yl)methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1cc(OC)c(OC)cc1Br)NCc1ncc(CC)s1.I |
| InChI | InChI=1S/C18H25BrN4O2S.HI/c1-5-13-10-21-17(26-13)11-23-18(20-6-2)22-9-12-7-15(24-3)16(25-4)8-14(12)19;/h7-8,10H,5-6,9,11H2,1-4H3,(H2,20,22,23);1H |
| InChIKey | WOWUASZNXJWRKO-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 67.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.31 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|