C16H26BrN3O2 — CID 111149776
2-[(2-bromo-4,5-dimethoxyphenyl)methyl]-1-butyl-3-ethylguanidine (PubChem CID 111149776) has the molecular formula C16H26BrN3O2 and a molecular weight of 372.31 g/mol. Its IUPAC name is 2-[(2-bromo-4,5-dimethoxyphenyl)methyl]-1-butyl-3-ethylguanidine.
| Compound Name | 2-[(2-bromo-4,5-dimethoxyphenyl)methyl]-1-butyl-3-ethylguanidine |
|---|---|
| PubChem CID | 111149776 |
| Molecular Formula | C16H26BrN3O2 |
| Molecular Weight | 372.31 g/mol |
| Exact Mass | 371.12 |
| IUPAC Name | 2-[(2-bromo-4,5-dimethoxyphenyl)methyl]-1-butyl-3-ethylguanidine |
| SMILES | CCCCN/C(=N/Cc1cc(OC)c(OC)cc1Br)NCC |
| InChI | InChI=1S/C16H26BrN3O2/c1-5-7-8-19-16(18-6-2)20-11-12-9-14(21-3)15(22-4)10-13(12)17/h9-10H,5-8,11H2,1-4H3,(H2,18,19,20) |
| InChIKey | JFKRGDLDETXBMI-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.31 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|