C17H24BrIN4O2S — CID 111523068
2-[(2-bromo-4,5-dimethoxyphenyl)methyl]-1-ethyl-3-[(5-methyl-1,3-thiazol-2-yl)methyl]guanidine;hydroiodide (PubChem CID 111523068) has the molecular formula C17H24BrIN4O2S and a molecular weight of 555.28 g/mol. Its IUPAC name is 2-[(2-bromo-4,5-dimethoxyphenyl)methyl]-1-ethyl-3-[(5-methyl-1,3-thiazol-2-yl)methyl]guanidine;hydroiodide.
| Compound Name | 2-[(2-bromo-4,5-dimethoxyphenyl)methyl]-1-ethyl-3-[(5-methyl-1,3-thiazol-2-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111523068 |
| Molecular Formula | C17H24BrIN4O2S |
| Molecular Weight | 555.28 g/mol |
| Exact Mass | 553.98 |
| IUPAC Name | 2-[(2-bromo-4,5-dimethoxyphenyl)methyl]-1-ethyl-3-[(5-methyl-1,3-thiazol-2-yl)methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1cc(OC)c(OC)cc1Br)NCc1ncc(C)s1.I |
| InChI | InChI=1S/C17H23BrN4O2S.HI/c1-5-19-17(22-10-16-20-8-11(2)25-16)21-9-12-6-14(23-3)15(24-4)7-13(12)18;/h6-8H,5,9-10H2,1-4H3,(H2,19,21,22);1H |
| InChIKey | ZLPJYEAZZPXZCC-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 67.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.28 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|