C18H26IN5O2S — CID 111523967
N-[5-[[[ethylamino-[(5-methyl-1,3-thiazol-2-yl)methylamino]methylidene]amino]methyl]-2-methoxyphenyl]acetamide;hydroiodide (PubChem CID 111523967) has the molecular formula C18H26IN5O2S and a molecular weight of 503.41 g/mol. Its IUPAC name is N-[5-[[[ethylamino-[(5-methyl-1,3-thiazol-2-yl)methylamino]methylidene]amino]methyl]-2-methoxyphenyl]acetamide;hydroiodide.
| Compound Name | N-[5-[[[ethylamino-[(5-methyl-1,3-thiazol-2-yl)methylamino]methylidene]amino]methyl]-2-methoxyphenyl]acetamide;hydroiodide |
|---|---|
| PubChem CID | 111523967 |
| Molecular Formula | C18H26IN5O2S |
| Molecular Weight | 503.41 g/mol |
| Exact Mass | 503.09 |
| IUPAC Name | N-[5-[[[ethylamino-[(5-methyl-1,3-thiazol-2-yl)methylamino]methylidene]amino]methyl]-2-methoxyphenyl]acetamide;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccc(OC)c(NC(C)=O)c1)NCc1ncc(C)s1.I |
| InChI | InChI=1S/C18H25N5O2S.HI/c1-5-19-18(22-11-17-20-9-12(2)26-17)21-10-14-6-7-16(25-4)15(8-14)23-13(3)24;/h6-9H,5,10-11H2,1-4H3,(H,23,24)(H2,19,21,22);1H |
| InChIKey | QWMIIDSKFJEJDZ-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 87.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.41 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|