C16H23IN4O2S — CID 111524651
1-ethyl-2-[(3-hydroxy-4-methoxyphenyl)methyl]-3-[(5-methyl-1,3-thiazol-2-yl)methyl]guanidine;hydroiodide (PubChem CID 111524651) has the molecular formula C16H23IN4O2S and a molecular weight of 462.36 g/mol. Its IUPAC name is 1-ethyl-2-[(3-hydroxy-4-methoxyphenyl)methyl]-3-[(5-methyl-1,3-thiazol-2-yl)methyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-2-[(3-hydroxy-4-methoxyphenyl)methyl]-3-[(5-methyl-1,3-thiazol-2-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111524651 |
| Molecular Formula | C16H23IN4O2S |
| Molecular Weight | 462.36 g/mol |
| Exact Mass | 462.06 |
| IUPAC Name | 1-ethyl-2-[(3-hydroxy-4-methoxyphenyl)methyl]-3-[(5-methyl-1,3-thiazol-2-yl)methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccc(OC)c(O)c1)NCc1ncc(C)s1.I |
| InChI | InChI=1S/C16H22N4O2S.HI/c1-4-17-16(20-10-15-18-8-11(2)23-15)19-9-12-5-6-14(22-3)13(21)7-12;/h5-8,21H,4,9-10H2,1-3H3,(H2,17,19,20);1H |
| InChIKey | SWEGZXPSMDVQBZ-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 78.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.36 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|