C21H29IN4O2 — CID 111899734
N-[5-[[[N-ethyl-N'-[(3-methylphenyl)methyl]carbamimidoyl]amino]methyl]-2-methoxyphenyl]acetamide;hydroiodide (PubChem CID 111899734) has the molecular formula C21H29IN4O2 and a molecular weight of 496.39 g/mol. Its IUPAC name is N-[5-[[[N-ethyl-N'-[(3-methylphenyl)methyl]carbamimidoyl]amino]methyl]-2-methoxyphenyl]acetamide;hydroiodide.
| Compound Name | N-[5-[[[N-ethyl-N'-[(3-methylphenyl)methyl]carbamimidoyl]amino]methyl]-2-methoxyphenyl]acetamide;hydroiodide |
|---|---|
| PubChem CID | 111899734 |
| Molecular Formula | C21H29IN4O2 |
| Molecular Weight | 496.39 g/mol |
| Exact Mass | 496.13 |
| IUPAC Name | N-[5-[[[N-ethyl-N'-[(3-methylphenyl)methyl]carbamimidoyl]amino]methyl]-2-methoxyphenyl]acetamide;hydroiodide |
| SMILES | CCN/C(=N\Cc1cccc(C)c1)NCc1ccc(OC)c(NC(C)=O)c1.I |
| InChI | InChI=1S/C21H28N4O2.HI/c1-5-22-21(23-13-17-8-6-7-15(2)11-17)24-14-18-9-10-20(27-4)19(12-18)25-16(3)26;/h6-12H,5,13-14H2,1-4H3,(H,25,26)(H2,22,23,24);1H |
| InChIKey | HGPIBHWHUVQELE-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 74.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.39 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|