C17H24IN5O2S — CID 111523965
N-[2-methoxy-5-[[[N'-methyl-N-[(5-methyl-1,3-thiazol-2-yl)methyl]carbamimidoyl]amino]methyl]phenyl]acetamide;hydroiodide (PubChem CID 111523965) has the molecular formula C17H24IN5O2S and a molecular weight of 489.38 g/mol. Its IUPAC name is N-[2-methoxy-5-[[[N'-methyl-N-[(5-methyl-1,3-thiazol-2-yl)methyl]carbamimidoyl]amino]methyl]phenyl]acetamide;hydroiodide.
| Compound Name | N-[2-methoxy-5-[[[N'-methyl-N-[(5-methyl-1,3-thiazol-2-yl)methyl]carbamimidoyl]amino]methyl]phenyl]acetamide;hydroiodide |
|---|---|
| PubChem CID | 111523965 |
| Molecular Formula | C17H24IN5O2S |
| Molecular Weight | 489.38 g/mol |
| Exact Mass | 489.07 |
| IUPAC Name | N-[2-methoxy-5-[[[N'-methyl-N-[(5-methyl-1,3-thiazol-2-yl)methyl]carbamimidoyl]amino]methyl]phenyl]acetamide;hydroiodide |
| SMILES | C/N=C(/NCc1ccc(OC)c(NC(C)=O)c1)NCc1ncc(C)s1.I |
| InChI | InChI=1S/C17H23N5O2S.HI/c1-11-8-19-16(25-11)10-21-17(18-3)20-9-13-5-6-15(24-4)14(7-13)22-12(2)23;/h5-8H,9-10H2,1-4H3,(H,22,23)(H2,18,20,21);1H |
| InChIKey | STKXUMCANRSKKN-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 87.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.38 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|