C17H22N4O2S — CID 111522444
ethyl 4-[[[N'-methyl-N-[(5-methyl-1,3-thiazol-2-yl)methyl]carbamimidoyl]amino]methyl]benzoate (PubChem CID 111522444) has the molecular formula C17H22N4O2S and a molecular weight of 346.46 g/mol. Its IUPAC name is ethyl 4-[[[N'-methyl-N-[(5-methyl-1,3-thiazol-2-yl)methyl]carbamimidoyl]amino]methyl]benzoate.
| Compound Name | ethyl 4-[[[N'-methyl-N-[(5-methyl-1,3-thiazol-2-yl)methyl]carbamimidoyl]amino]methyl]benzoate |
|---|---|
| PubChem CID | 111522444 |
| Molecular Formula | C17H22N4O2S |
| Molecular Weight | 346.46 g/mol |
| Exact Mass | 346.15 |
| IUPAC Name | ethyl 4-[[[N'-methyl-N-[(5-methyl-1,3-thiazol-2-yl)methyl]carbamimidoyl]amino]methyl]benzoate |
| SMILES | CCOC(=O)c1ccc(CN/C(=N/C)NCc2ncc(C)s2)cc1 |
| InChI | InChI=1S/C17H22N4O2S/c1-4-23-16(22)14-7-5-13(6-8-14)10-20-17(18-3)21-11-15-19-9-12(2)24-15/h5-9H,4,10-11H2,1-3H3,(H2,18,20,21) |
| InChIKey | GYWAAHOEZZBGDH-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 75.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.46 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|