C16H25N3O2 — CID 111179975
ethyl 4-[[[N'-methyl-N-(2-methylpropyl)carbamimidoyl]amino]methyl]benzoate (PubChem CID 111179975) has the molecular formula C16H25N3O2 and a molecular weight of 291.40 g/mol. Its IUPAC name is ethyl 4-[[[N'-methyl-N-(2-methylpropyl)carbamimidoyl]amino]methyl]benzoate.
| Compound Name | ethyl 4-[[[N'-methyl-N-(2-methylpropyl)carbamimidoyl]amino]methyl]benzoate |
|---|---|
| PubChem CID | 111179975 |
| Molecular Formula | C16H25N3O2 |
| Molecular Weight | 291.40 g/mol |
| Exact Mass | 291.19 |
| IUPAC Name | ethyl 4-[[[N'-methyl-N-(2-methylpropyl)carbamimidoyl]amino]methyl]benzoate |
| SMILES | CCOC(=O)c1ccc(CN/C(=N/C)NCC(C)C)cc1 |
| InChI | InChI=1S/C16H25N3O2/c1-5-21-15(20)14-8-6-13(7-9-14)11-19-16(17-4)18-10-12(2)3/h6-9,12H,5,10-11H2,1-4H3,(H2,17,18,19) |
| InChIKey | MXOIWHAGROCOHF-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 62.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.40 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|