C21H27N3O2 — CID 111198968
ethyl 4-[[[N'-methyl-N-(3-phenylpropyl)carbamimidoyl]amino]methyl]benzoate (PubChem CID 111198968) has the molecular formula C21H27N3O2 and a molecular weight of 353.47 g/mol. Its IUPAC name is ethyl 4-[[[N'-methyl-N-(3-phenylpropyl)carbamimidoyl]amino]methyl]benzoate.
| Compound Name | ethyl 4-[[[N'-methyl-N-(3-phenylpropyl)carbamimidoyl]amino]methyl]benzoate |
|---|---|
| PubChem CID | 111198968 |
| Molecular Formula | C21H27N3O2 |
| Molecular Weight | 353.47 g/mol |
| Exact Mass | 353.21 |
| IUPAC Name | ethyl 4-[[[N'-methyl-N-(3-phenylpropyl)carbamimidoyl]amino]methyl]benzoate |
| SMILES | CCOC(=O)c1ccc(CN/C(=N/C)NCCCc2ccccc2)cc1 |
| InChI | InChI=1S/C21H27N3O2/c1-3-26-20(25)19-13-11-18(12-14-19)16-24-21(22-2)23-15-7-10-17-8-5-4-6-9-17/h4-6,8-9,11-14H,3,7,10,15-16H2,1-2H3,(H2,22,23,24) |
| InChIKey | XQTIZUDWRVVXMB-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 62.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.47 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|