C22H24N4O3 — CID 111552202
ethyl 4-[[[N'-methyl-N-[(2-phenyl-1,3-oxazol-4-yl)methyl]carbamimidoyl]amino]methyl]benzoate (PubChem CID 111552202) has the molecular formula C22H24N4O3 and a molecular weight of 392.46 g/mol. Its IUPAC name is ethyl 4-[[[N'-methyl-N-[(2-phenyl-1,3-oxazol-4-yl)methyl]carbamimidoyl]amino]methyl]benzoate.
| Compound Name | ethyl 4-[[[N'-methyl-N-[(2-phenyl-1,3-oxazol-4-yl)methyl]carbamimidoyl]amino]methyl]benzoate |
|---|---|
| PubChem CID | 111552202 |
| Molecular Formula | C22H24N4O3 |
| Molecular Weight | 392.46 g/mol |
| Exact Mass | 392.18 |
| IUPAC Name | ethyl 4-[[[N'-methyl-N-[(2-phenyl-1,3-oxazol-4-yl)methyl]carbamimidoyl]amino]methyl]benzoate |
| SMILES | CCOC(=O)c1ccc(CN/C(=N/C)NCc2coc(-c3ccccc3)n2)cc1 |
| InChI | InChI=1S/C22H24N4O3/c1-3-28-21(27)18-11-9-16(10-12-18)13-24-22(23-2)25-14-19-15-29-20(26-19)17-7-5-4-6-8-17/h4-12,15H,3,13-14H2,1-2H3,(H2,23,24,25) |
| InChIKey | SJDYVERLZZNXRE-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 88.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.46 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|