C19H22IN5O3S — CID 111551811
2-methyl-1-[(2-phenyl-1,3-oxazol-4-yl)methyl]-3-[(4-sulfamoylphenyl)methyl]guanidine;hydroiodide (PubChem CID 111551811) has the molecular formula C19H22IN5O3S and a molecular weight of 527.39 g/mol. Its IUPAC name is 2-methyl-1-[(2-phenyl-1,3-oxazol-4-yl)methyl]-3-[(4-sulfamoylphenyl)methyl]guanidine;hydroiodide.
| Compound Name | 2-methyl-1-[(2-phenyl-1,3-oxazol-4-yl)methyl]-3-[(4-sulfamoylphenyl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111551811 |
| Molecular Formula | C19H22IN5O3S |
| Molecular Weight | 527.39 g/mol |
| Exact Mass | 527.05 |
| IUPAC Name | 2-methyl-1-[(2-phenyl-1,3-oxazol-4-yl)methyl]-3-[(4-sulfamoylphenyl)methyl]guanidine;hydroiodide |
| SMILES | C/N=C(/NCc1ccc(S(N)(=O)=O)cc1)NCc1coc(-c2ccccc2)n1.I |
| InChI | InChI=1S/C19H21N5O3S.HI/c1-21-19(22-11-14-7-9-17(10-8-14)28(20,25)26)23-12-16-13-27-18(24-16)15-5-3-2-4-6-15;/h2-10,13H,11-12H2,1H3,(H2,20,25,26)(H2,21,22,23);1H |
| InChIKey | MBMCHSJWTSBLOX-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 122.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.39 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|