C21H28IN3O2 — CID 111199397
methyl 4-[2-[[N'-methyl-N-(3-phenylpropyl)carbamimidoyl]amino]ethyl]benzoate;hydroiodide (PubChem CID 111199397) has the molecular formula C21H28IN3O2 and a molecular weight of 481.38 g/mol. Its IUPAC name is methyl 4-[2-[[N'-methyl-N-(3-phenylpropyl)carbamimidoyl]amino]ethyl]benzoate;hydroiodide.
| Compound Name | methyl 4-[2-[[N'-methyl-N-(3-phenylpropyl)carbamimidoyl]amino]ethyl]benzoate;hydroiodide |
|---|---|
| PubChem CID | 111199397 |
| Molecular Formula | C21H28IN3O2 |
| Molecular Weight | 481.38 g/mol |
| Exact Mass | 481.12 |
| IUPAC Name | methyl 4-[2-[[N'-methyl-N-(3-phenylpropyl)carbamimidoyl]amino]ethyl]benzoate;hydroiodide |
| SMILES | C/N=C(\NCCCc1ccccc1)NCCc1ccc(C(=O)OC)cc1.I |
| InChI | InChI=1S/C21H27N3O2.HI/c1-22-21(23-15-6-9-17-7-4-3-5-8-17)24-16-14-18-10-12-19(13-11-18)20(25)26-2;/h3-5,7-8,10-13H,6,9,14-16H2,1-2H3,(H2,22,23,24);1H |
| InChIKey | JTLUAUVPPQIZBH-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 62.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.38 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|