C18H25IN4O2S — CID 111932295
ethyl 4-[[[N'-methyl-N-[2-(2-methyl-1,3-thiazol-4-yl)ethyl]carbamimidoyl]amino]methyl]benzoate;hydroiodide (PubChem CID 111932295) has the molecular formula C18H25IN4O2S and a molecular weight of 488.40 g/mol. Its IUPAC name is ethyl 4-[[[N'-methyl-N-[2-(2-methyl-1,3-thiazol-4-yl)ethyl]carbamimidoyl]amino]methyl]benzoate;hydroiodide.
| Compound Name | ethyl 4-[[[N'-methyl-N-[2-(2-methyl-1,3-thiazol-4-yl)ethyl]carbamimidoyl]amino]methyl]benzoate;hydroiodide |
|---|---|
| PubChem CID | 111932295 |
| Molecular Formula | C18H25IN4O2S |
| Molecular Weight | 488.40 g/mol |
| Exact Mass | 488.07 |
| IUPAC Name | ethyl 4-[[[N'-methyl-N-[2-(2-methyl-1,3-thiazol-4-yl)ethyl]carbamimidoyl]amino]methyl]benzoate;hydroiodide |
| SMILES | CCOC(=O)c1ccc(CN/C(=N/C)NCCc2csc(C)n2)cc1.I |
| InChI | InChI=1S/C18H24N4O2S.HI/c1-4-24-17(23)15-7-5-14(6-8-15)11-21-18(19-3)20-10-9-16-12-25-13(2)22-16;/h5-8,12H,4,9-11H2,1-3H3,(H2,19,20,21);1H |
| InChIKey | KNXQVCUIPODPKG-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 75.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.40 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|