C15H22IN5S — CID 111933684
2-methyl-1-[(6-methyl-2-pyridinyl)methyl]-3-[2-(2-methyl-1,3-thiazol-4-yl)ethyl]guanidine;hydroiodide (PubChem CID 111933684) has the molecular formula C15H22IN5S and a molecular weight of 431.35 g/mol. Its IUPAC name is 2-methyl-1-[(6-methyl-2-pyridinyl)methyl]-3-[2-(2-methyl-1,3-thiazol-4-yl)ethyl]guanidine;hydroiodide.
| Compound Name | 2-methyl-1-[(6-methyl-2-pyridinyl)methyl]-3-[2-(2-methyl-1,3-thiazol-4-yl)ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111933684 |
| Molecular Formula | C15H22IN5S |
| Molecular Weight | 431.35 g/mol |
| Exact Mass | 431.06 |
| IUPAC Name | 2-methyl-1-[(6-methyl-2-pyridinyl)methyl]-3-[2-(2-methyl-1,3-thiazol-4-yl)ethyl]guanidine;hydroiodide |
| SMILES | C/N=C(\NCCc1csc(C)n1)NCc1cccc(C)n1.I |
| InChI | InChI=1S/C15H21N5S.HI/c1-11-5-4-6-13(19-11)9-18-15(16-3)17-8-7-14-10-21-12(2)20-14;/h4-6,10H,7-9H2,1-3H3,(H2,16,17,18);1H |
| InChIKey | NNJHYHRCAPTTNI-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 62.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.35 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|