C13H20IN5S2 — CID 111523587
2-methyl-1-[2-(2-methyl-1,3-thiazol-4-yl)ethyl]-3-[(5-methyl-1,3-thiazol-2-yl)methyl]guanidine;hydroiodide (PubChem CID 111523587) has the molecular formula C13H20IN5S2 and a molecular weight of 437.38 g/mol. Its IUPAC name is 2-methyl-1-[2-(2-methyl-1,3-thiazol-4-yl)ethyl]-3-[(5-methyl-1,3-thiazol-2-yl)methyl]guanidine;hydroiodide.
| Compound Name | 2-methyl-1-[2-(2-methyl-1,3-thiazol-4-yl)ethyl]-3-[(5-methyl-1,3-thiazol-2-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111523587 |
| Molecular Formula | C13H20IN5S2 |
| Molecular Weight | 437.38 g/mol |
| Exact Mass | 437.02 |
| IUPAC Name | 2-methyl-1-[2-(2-methyl-1,3-thiazol-4-yl)ethyl]-3-[(5-methyl-1,3-thiazol-2-yl)methyl]guanidine;hydroiodide |
| SMILES | C/N=C(\NCCc1csc(C)n1)NCc1ncc(C)s1.I |
| InChI | InChI=1S/C13H19N5S2.HI/c1-9-6-16-12(20-9)7-17-13(14-3)15-5-4-11-8-19-10(2)18-11;/h6,8H,4-5,7H2,1-3H3,(H2,14,15,17);1H |
| InChIKey | QSJNGPOBVPKZKF-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 62.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.38 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|