C13H20N6S — CID 119150859
2-methyl-1-[(5-methyl-1H-pyrazol-4-yl)methyl]-3-[2-(2-methyl-1,3-thiazol-4-yl)ethyl]guanidine (PubChem CID 119150859) has the molecular formula C13H20N6S and a molecular weight of 292.41 g/mol. Its IUPAC name is 2-methyl-1-[(5-methyl-1H-pyrazol-4-yl)methyl]-3-[2-(2-methyl-1,3-thiazol-4-yl)ethyl]guanidine.
| Compound Name | 2-methyl-1-[(5-methyl-1H-pyrazol-4-yl)methyl]-3-[2-(2-methyl-1,3-thiazol-4-yl)ethyl]guanidine |
|---|---|
| PubChem CID | 119150859 |
| Molecular Formula | C13H20N6S |
| Molecular Weight | 292.41 g/mol |
| Exact Mass | 292.15 |
| IUPAC Name | 2-methyl-1-[(5-methyl-1H-pyrazol-4-yl)methyl]-3-[2-(2-methyl-1,3-thiazol-4-yl)ethyl]guanidine |
| SMILES | C/N=C(\NCCc1csc(C)n1)NCc1cn[nH]c1C |
| InChI | InChI=1S/C13H20N6S/c1-9-11(7-17-19-9)6-16-13(14-3)15-5-4-12-8-20-10(2)18-12/h7-8H,4-6H2,1-3H3,(H,17,19)(H2,14,15,16) |
| InChIKey | WGEOAEVKSYWGGZ-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 77.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.41 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|