C11H21IN4O2S2 — CID 111525529
1-(2-ethylsulfonylethyl)-2-methyl-3-[(5-methyl-1,3-thiazol-2-yl)methyl]guanidine;hydroiodide (PubChem CID 111525529) has the molecular formula C11H21IN4O2S2 and a molecular weight of 432.35 g/mol. Its IUPAC name is 1-(2-ethylsulfonylethyl)-2-methyl-3-[(5-methyl-1,3-thiazol-2-yl)methyl]guanidine;hydroiodide.
| Compound Name | 1-(2-ethylsulfonylethyl)-2-methyl-3-[(5-methyl-1,3-thiazol-2-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111525529 |
| Molecular Formula | C11H21IN4O2S2 |
| Molecular Weight | 432.35 g/mol |
| Exact Mass | 432.02 |
| IUPAC Name | 1-(2-ethylsulfonylethyl)-2-methyl-3-[(5-methyl-1,3-thiazol-2-yl)methyl]guanidine;hydroiodide |
| SMILES | CCS(=O)(=O)CCN/C(=N\C)NCc1ncc(C)s1.I |
| InChI | InChI=1S/C11H20N4O2S2.HI/c1-4-19(16,17)6-5-13-11(12-3)15-8-10-14-7-9(2)18-10;/h7H,4-6,8H2,1-3H3,(H2,12,13,15);1H |
| InChIKey | NUEBSPHPIFEECU-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.35 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|