C17H23FIN5OS — CID 111523478
2-(4-fluorophenyl)-N-[2-[[N'-methyl-N-[(5-methyl-1,3-thiazol-2-yl)methyl]carbamimidoyl]amino]ethyl]acetamide;hydroiodide (PubChem CID 111523478) has the molecular formula C17H23FIN5OS and a molecular weight of 491.37 g/mol. Its IUPAC name is 2-(4-fluorophenyl)-N-[2-[[N'-methyl-N-[(5-methyl-1,3-thiazol-2-yl)methyl]carbamimidoyl]amino]ethyl]acetamide;hydroiodide.
| Compound Name | 2-(4-fluorophenyl)-N-[2-[[N'-methyl-N-[(5-methyl-1,3-thiazol-2-yl)methyl]carbamimidoyl]amino]ethyl]acetamide;hydroiodide |
|---|---|
| PubChem CID | 111523478 |
| Molecular Formula | C17H23FIN5OS |
| Molecular Weight | 491.37 g/mol |
| Exact Mass | 491.07 |
| IUPAC Name | 2-(4-fluorophenyl)-N-[2-[[N'-methyl-N-[(5-methyl-1,3-thiazol-2-yl)methyl]carbamimidoyl]amino]ethyl]acetamide;hydroiodide |
| SMILES | C/N=C(/NCCNC(=O)Cc1ccc(F)cc1)NCc1ncc(C)s1.I |
| InChI | InChI=1S/C17H22FN5OS.HI/c1-12-10-22-16(25-12)11-23-17(19-2)21-8-7-20-15(24)9-13-3-5-14(18)6-4-13;/h3-6,10H,7-9,11H2,1-2H3,(H,20,24)(H2,19,21,23);1H |
| InChIKey | DHGSRGLROBJUJQ-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 78.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.37 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|