C23H27FIN5O2 — CID 111591534
2-(4-fluorophenyl)-N-[2-[[N'-methyl-N-[[2-(4-methylphenyl)-1,3-oxazol-4-yl]methyl]carbamimidoyl]amino]ethyl]acetamide;hydroiodide (PubChem CID 111591534) has the molecular formula C23H27FIN5O2 and a molecular weight of 551.40 g/mol. Its IUPAC name is 2-(4-fluorophenyl)-N-[2-[[N'-methyl-N-[[2-(4-methylphenyl)-1,3-oxazol-4-yl]methyl]carbamimidoyl]amino]ethyl]acetamide;hydroiodide.
| Compound Name | 2-(4-fluorophenyl)-N-[2-[[N'-methyl-N-[[2-(4-methylphenyl)-1,3-oxazol-4-yl]methyl]carbamimidoyl]amino]ethyl]acetamide;hydroiodide |
|---|---|
| PubChem CID | 111591534 |
| Molecular Formula | C23H27FIN5O2 |
| Molecular Weight | 551.40 g/mol |
| Exact Mass | 551.12 |
| IUPAC Name | 2-(4-fluorophenyl)-N-[2-[[N'-methyl-N-[[2-(4-methylphenyl)-1,3-oxazol-4-yl]methyl]carbamimidoyl]amino]ethyl]acetamide;hydroiodide |
| SMILES | C/N=C(\NCCNC(=O)Cc1ccc(F)cc1)NCc1coc(-c2ccc(C)cc2)n1.I |
| InChI | InChI=1S/C23H26FN5O2.HI/c1-16-3-7-18(8-4-16)22-29-20(15-31-22)14-28-23(25-2)27-12-11-26-21(30)13-17-5-9-19(24)10-6-17;/h3-10,15H,11-14H2,1-2H3,(H,26,30)(H2,25,27,28);1H |
| InChIKey | OVHVTKXTEDFSBQ-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 91.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.40 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|