C19H22ClIN4OS — CID 111590926
1-[2-(5-chlorothiophen-2-yl)ethyl]-2-methyl-3-[[2-(4-methylphenyl)-1,3-oxazol-4-yl]methyl]guanidine;hydroiodide (PubChem CID 111590926) has the molecular formula C19H22ClIN4OS and a molecular weight of 516.84 g/mol. Its IUPAC name is 1-[2-(5-chlorothiophen-2-yl)ethyl]-2-methyl-3-[[2-(4-methylphenyl)-1,3-oxazol-4-yl]methyl]guanidine;hydroiodide.
| Compound Name | 1-[2-(5-chlorothiophen-2-yl)ethyl]-2-methyl-3-[[2-(4-methylphenyl)-1,3-oxazol-4-yl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111590926 |
| Molecular Formula | C19H22ClIN4OS |
| Molecular Weight | 516.84 g/mol |
| Exact Mass | 516.02 |
| IUPAC Name | 1-[2-(5-chlorothiophen-2-yl)ethyl]-2-methyl-3-[[2-(4-methylphenyl)-1,3-oxazol-4-yl]methyl]guanidine;hydroiodide |
| SMILES | C/N=C(\NCCc1ccc(Cl)s1)NCc1coc(-c2ccc(C)cc2)n1.I |
| InChI | InChI=1S/C19H21ClN4OS.HI/c1-13-3-5-14(6-4-13)18-24-15(12-25-18)11-23-19(21-2)22-10-9-16-7-8-17(20)26-16;/h3-8,12H,9-11H2,1-2H3,(H2,21,22,23);1H |
| InChIKey | OJAGPSIZQDVKAZ-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 62.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.84 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|