C16H19IN4O — CID 111590274
2-methyl-1-[[2-(4-methylphenyl)-1,3-oxazol-4-yl]methyl]-3-prop-2-ynylguanidine;hydroiodide (PubChem CID 111590274) has the molecular formula C16H19IN4O and a molecular weight of 410.26 g/mol. Its IUPAC name is 2-methyl-1-[[2-(4-methylphenyl)-1,3-oxazol-4-yl]methyl]-3-prop-2-ynylguanidine;hydroiodide.
| Compound Name | 2-methyl-1-[[2-(4-methylphenyl)-1,3-oxazol-4-yl]methyl]-3-prop-2-ynylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111590274 |
| Molecular Formula | C16H19IN4O |
| Molecular Weight | 410.26 g/mol |
| Exact Mass | 410.06 |
| IUPAC Name | 2-methyl-1-[[2-(4-methylphenyl)-1,3-oxazol-4-yl]methyl]-3-prop-2-ynylguanidine;hydroiodide |
| SMILES | C#CCN/C(=N\C)NCc1coc(-c2ccc(C)cc2)n1.I |
| InChI | InChI=1S/C16H18N4O.HI/c1-4-9-18-16(17-3)19-10-14-11-21-15(20-14)13-7-5-12(2)6-8-13;/h1,5-8,11H,9-10H2,2-3H3,(H2,17,18,19);1H |
| InChIKey | WAUFZBNIUNVTTJ-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 62.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.26 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|