C18H24IN7O — CID 111590712
1-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-2-methyl-3-[[2-(4-methylphenyl)-1,3-oxazol-4-yl]methyl]guanidine;hydroiodide (PubChem CID 111590712) has the molecular formula C18H24IN7O and a molecular weight of 481.34 g/mol. Its IUPAC name is 1-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-2-methyl-3-[[2-(4-methylphenyl)-1,3-oxazol-4-yl]methyl]guanidine;hydroiodide.
| Compound Name | 1-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-2-methyl-3-[[2-(4-methylphenyl)-1,3-oxazol-4-yl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111590712 |
| Molecular Formula | C18H24IN7O |
| Molecular Weight | 481.34 g/mol |
| Exact Mass | 481.11 |
| IUPAC Name | 1-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-2-methyl-3-[[2-(4-methylphenyl)-1,3-oxazol-4-yl]methyl]guanidine;hydroiodide |
| SMILES | C/N=C(/NCc1coc(-c2ccc(C)cc2)n1)NCc1nnc(C)n1C.I |
| InChI | InChI=1S/C18H23N7O.HI/c1-12-5-7-14(8-6-12)17-22-15(11-26-17)9-20-18(19-3)21-10-16-24-23-13(2)25(16)4;/h5-8,11H,9-10H2,1-4H3,(H2,19,20,21);1H |
| InChIKey | VAXUGLTVBYHQOL-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 93.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.34 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|