C18H20BrIN4OS — CID 111591990
1-[(4-bromothiophen-2-yl)methyl]-2-methyl-3-[[2-(4-methylphenyl)-1,3-oxazol-4-yl]methyl]guanidine;hydroiodide (PubChem CID 111591990) has the molecular formula C18H20BrIN4OS and a molecular weight of 547.26 g/mol. Its IUPAC name is 1-[(4-bromothiophen-2-yl)methyl]-2-methyl-3-[[2-(4-methylphenyl)-1,3-oxazol-4-yl]methyl]guanidine;hydroiodide.
| Compound Name | 1-[(4-bromothiophen-2-yl)methyl]-2-methyl-3-[[2-(4-methylphenyl)-1,3-oxazol-4-yl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111591990 |
| Molecular Formula | C18H20BrIN4OS |
| Molecular Weight | 547.26 g/mol |
| Exact Mass | 545.96 |
| IUPAC Name | 1-[(4-bromothiophen-2-yl)methyl]-2-methyl-3-[[2-(4-methylphenyl)-1,3-oxazol-4-yl]methyl]guanidine;hydroiodide |
| SMILES | C/N=C(/NCc1coc(-c2ccc(C)cc2)n1)NCc1cc(Br)cs1.I |
| InChI | InChI=1S/C18H19BrN4OS.HI/c1-12-3-5-13(6-4-12)17-23-15(10-24-17)8-21-18(20-2)22-9-16-7-14(19)11-25-16;/h3-7,10-11H,8-9H2,1-2H3,(H2,20,21,22);1H |
| InChIKey | XLTQXWPKWDBPLB-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 62.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.26 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|