C15H21IN4O — CID 111591604
1,1,2-trimethyl-3-[[2-(4-methylphenyl)-1,3-oxazol-4-yl]methyl]guanidine;hydroiodide (PubChem CID 111591604) has the molecular formula C15H21IN4O and a molecular weight of 400.26 g/mol. Its IUPAC name is 1,1,2-trimethyl-3-[[2-(4-methylphenyl)-1,3-oxazol-4-yl]methyl]guanidine;hydroiodide.
| Compound Name | 1,1,2-trimethyl-3-[[2-(4-methylphenyl)-1,3-oxazol-4-yl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111591604 |
| Molecular Formula | C15H21IN4O |
| Molecular Weight | 400.26 g/mol |
| Exact Mass | 400.08 |
| IUPAC Name | 1,1,2-trimethyl-3-[[2-(4-methylphenyl)-1,3-oxazol-4-yl]methyl]guanidine;hydroiodide |
| SMILES | C/N=C(/NCc1coc(-c2ccc(C)cc2)n1)N(C)C.I |
| InChI | InChI=1S/C15H20N4O.HI/c1-11-5-7-12(8-6-11)14-18-13(10-20-14)9-17-15(16-2)19(3)4;/h5-8,10H,9H2,1-4H3,(H,16,17);1H |
| InChIKey | ISGUTMVVMUGWPL-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 53.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.26 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|