C24H31IN4O4 — CID 111590944
2-methyl-1-[[2-(4-methylphenyl)-1,3-oxazol-4-yl]methyl]-3-[2-(2,3,4-trimethoxyphenyl)ethyl]guanidine;hydroiodide (PubChem CID 111590944) has the molecular formula C24H31IN4O4 and a molecular weight of 566.44 g/mol. Its IUPAC name is 2-methyl-1-[[2-(4-methylphenyl)-1,3-oxazol-4-yl]methyl]-3-[2-(2,3,4-trimethoxyphenyl)ethyl]guanidine;hydroiodide.
| Compound Name | 2-methyl-1-[[2-(4-methylphenyl)-1,3-oxazol-4-yl]methyl]-3-[2-(2,3,4-trimethoxyphenyl)ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111590944 |
| Molecular Formula | C24H31IN4O4 |
| Molecular Weight | 566.44 g/mol |
| Exact Mass | 566.14 |
| IUPAC Name | 2-methyl-1-[[2-(4-methylphenyl)-1,3-oxazol-4-yl]methyl]-3-[2-(2,3,4-trimethoxyphenyl)ethyl]guanidine;hydroiodide |
| SMILES | C/N=C(/NCCc1ccc(OC)c(OC)c1OC)NCc1coc(-c2ccc(C)cc2)n1.I |
| InChI | InChI=1S/C24H30N4O4.HI/c1-16-6-8-18(9-7-16)23-28-19(15-32-23)14-27-24(25-2)26-13-12-17-10-11-20(29-3)22(31-5)21(17)30-4;/h6-11,15H,12-14H2,1-5H3,(H2,25,26,27);1H |
| InChIKey | GVODPUBMROHDTH-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 90.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.44 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|