C22H25FIN5O2 — CID 111553684
2-(3-fluorophenyl)-N-[2-[[N'-methyl-N-[(2-phenyl-1,3-oxazol-4-yl)methyl]carbamimidoyl]amino]ethyl]acetamide;hydroiodide (PubChem CID 111553684) has the molecular formula C22H25FIN5O2 and a molecular weight of 537.38 g/mol. Its IUPAC name is 2-(3-fluorophenyl)-N-[2-[[N'-methyl-N-[(2-phenyl-1,3-oxazol-4-yl)methyl]carbamimidoyl]amino]ethyl]acetamide;hydroiodide.
| Compound Name | 2-(3-fluorophenyl)-N-[2-[[N'-methyl-N-[(2-phenyl-1,3-oxazol-4-yl)methyl]carbamimidoyl]amino]ethyl]acetamide;hydroiodide |
|---|---|
| PubChem CID | 111553684 |
| Molecular Formula | C22H25FIN5O2 |
| Molecular Weight | 537.38 g/mol |
| Exact Mass | 537.10 |
| IUPAC Name | 2-(3-fluorophenyl)-N-[2-[[N'-methyl-N-[(2-phenyl-1,3-oxazol-4-yl)methyl]carbamimidoyl]amino]ethyl]acetamide;hydroiodide |
| SMILES | C/N=C(/NCCNC(=O)Cc1cccc(F)c1)NCc1coc(-c2ccccc2)n1.I |
| InChI | InChI=1S/C22H24FN5O2.HI/c1-24-22(26-11-10-25-20(29)13-16-6-5-9-18(23)12-16)27-14-19-15-30-21(28-19)17-7-3-2-4-8-17;/h2-9,12,15H,10-11,13-14H2,1H3,(H,25,29)(H2,24,26,27);1H |
| InChIKey | UEISXLOFILWGRI-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 91.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.38 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|