C22H22FN5O — CID 111980337
1-[2-(5-fluoro-1H-indol-3-yl)ethyl]-2-methyl-3-[(2-phenyl-1,3-oxazol-4-yl)methyl]guanidine (PubChem CID 111980337) has the molecular formula C22H22FN5O and a molecular weight of 391.45 g/mol. Its IUPAC name is 1-[2-(5-fluoro-1H-indol-3-yl)ethyl]-2-methyl-3-[(2-phenyl-1,3-oxazol-4-yl)methyl]guanidine.
| Compound Name | 1-[2-(5-fluoro-1H-indol-3-yl)ethyl]-2-methyl-3-[(2-phenyl-1,3-oxazol-4-yl)methyl]guanidine |
|---|---|
| PubChem CID | 111980337 |
| Molecular Formula | C22H22FN5O |
| Molecular Weight | 391.45 g/mol |
| Exact Mass | 391.18 |
| IUPAC Name | 1-[2-(5-fluoro-1H-indol-3-yl)ethyl]-2-methyl-3-[(2-phenyl-1,3-oxazol-4-yl)methyl]guanidine |
| SMILES | C/N=C(/NCCc1c[nH]c2ccc(F)cc12)NCc1coc(-c2ccccc2)n1 |
| InChI | InChI=1S/C22H22FN5O/c1-24-22(25-10-9-16-12-26-20-8-7-17(23)11-19(16)20)27-13-18-14-29-21(28-18)15-5-3-2-4-6-15/h2-8,11-12,14,26H,9-10,13H2,1H3,(H2,24,25,27) |
| InChIKey | BYQJQBFBCFWGNM-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 78.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.45 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|