C20H21N5OS — CID 110995795
1-[2-(1H-indol-3-yl)ethyl]-2-methyl-3-[(2-thiophen-2-yl-1,3-oxazol-4-yl)methyl]guanidine (PubChem CID 110995795) has the molecular formula C20H21N5OS and a molecular weight of 379.49 g/mol. Its IUPAC name is 1-[2-(1H-indol-3-yl)ethyl]-2-methyl-3-[(2-thiophen-2-yl-1,3-oxazol-4-yl)methyl]guanidine.
| Compound Name | 1-[2-(1H-indol-3-yl)ethyl]-2-methyl-3-[(2-thiophen-2-yl-1,3-oxazol-4-yl)methyl]guanidine |
|---|---|
| PubChem CID | 110995795 |
| Molecular Formula | C20H21N5OS |
| Molecular Weight | 379.49 g/mol |
| Exact Mass | 379.15 |
| IUPAC Name | 1-[2-(1H-indol-3-yl)ethyl]-2-methyl-3-[(2-thiophen-2-yl-1,3-oxazol-4-yl)methyl]guanidine |
| SMILES | C/N=C(/NCCc1c[nH]c2ccccc12)NCc1coc(-c2cccs2)n1 |
| InChI | InChI=1S/C20H21N5OS/c1-21-20(22-9-8-14-11-23-17-6-3-2-5-16(14)17)24-12-15-13-26-19(25-15)18-7-4-10-27-18/h2-7,10-11,13,23H,8-9,12H2,1H3,(H2,21,22,24) |
| InChIKey | WLQUZHWOEJTBMM-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 78.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.49 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|