C16H21N7OS — CID 111699303
1-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-2-methyl-3-[(2-thiophen-2-yl-1,3-oxazol-4-yl)methyl]guanidine (PubChem CID 111699303) has the molecular formula C16H21N7OS and a molecular weight of 359.46 g/mol. Its IUPAC name is 1-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-2-methyl-3-[(2-thiophen-2-yl-1,3-oxazol-4-yl)methyl]guanidine.
| Compound Name | 1-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-2-methyl-3-[(2-thiophen-2-yl-1,3-oxazol-4-yl)methyl]guanidine |
|---|---|
| PubChem CID | 111699303 |
| Molecular Formula | C16H21N7OS |
| Molecular Weight | 359.46 g/mol |
| Exact Mass | 359.15 |
| IUPAC Name | 1-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-2-methyl-3-[(2-thiophen-2-yl-1,3-oxazol-4-yl)methyl]guanidine |
| SMILES | CCc1nncn1CCN/C(=N\C)NCc1coc(-c2cccs2)n1 |
| InChI | InChI=1S/C16H21N7OS/c1-3-14-22-20-11-23(14)7-6-18-16(17-2)19-9-12-10-24-15(21-12)13-5-4-8-25-13/h4-5,8,10-11H,3,6-7,9H2,1-2H3,(H2,17,18,19) |
| InChIKey | XMTULYJZHQQYHF-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 93.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.46 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|