C13H19IN4O2S — CID 110940049
1-(2-methoxyethyl)-2-methyl-3-[(2-thiophen-2-yl-1,3-oxazol-4-yl)methyl]guanidine;hydroiodide (PubChem CID 110940049) has the molecular formula C13H19IN4O2S and a molecular weight of 422.29 g/mol. Its IUPAC name is 1-(2-methoxyethyl)-2-methyl-3-[(2-thiophen-2-yl-1,3-oxazol-4-yl)methyl]guanidine;hydroiodide.
| Compound Name | 1-(2-methoxyethyl)-2-methyl-3-[(2-thiophen-2-yl-1,3-oxazol-4-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 110940049 |
| Molecular Formula | C13H19IN4O2S |
| Molecular Weight | 422.29 g/mol |
| Exact Mass | 422.03 |
| IUPAC Name | 1-(2-methoxyethyl)-2-methyl-3-[(2-thiophen-2-yl-1,3-oxazol-4-yl)methyl]guanidine;hydroiodide |
| SMILES | C/N=C(\NCCOC)NCc1coc(-c2cccs2)n1.I |
| InChI | InChI=1S/C13H18N4O2S.HI/c1-14-13(15-5-6-18-2)16-8-10-9-19-12(17-10)11-4-3-7-20-11;/h3-4,7,9H,5-6,8H2,1-2H3,(H2,14,15,16);1H |
| InChIKey | BOCAFGIDABOGSV-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 71.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.29 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|