C13H18ClN3O3S — CID 119698131
2-(2-methoxyethylamino)-N-[(2-thiophen-2-yl-1,3-oxazol-4-yl)methyl]acetamide;hydrochloride (PubChem CID 119698131) has the molecular formula C13H18ClN3O3S and a molecular weight of 331.82 g/mol. Its IUPAC name is 2-(2-methoxyethylamino)-N-[(2-thiophen-2-yl-1,3-oxazol-4-yl)methyl]acetamide;hydrochloride.
| Compound Name | 2-(2-methoxyethylamino)-N-[(2-thiophen-2-yl-1,3-oxazol-4-yl)methyl]acetamide;hydrochloride |
|---|---|
| PubChem CID | 119698131 |
| Molecular Formula | C13H18ClN3O3S |
| Molecular Weight | 331.82 g/mol |
| Exact Mass | 331.08 |
| IUPAC Name | 2-(2-methoxyethylamino)-N-[(2-thiophen-2-yl-1,3-oxazol-4-yl)methyl]acetamide;hydrochloride |
| SMILES | COCCNCC(=O)NCc1coc(-c2cccs2)n1.Cl |
| InChI | InChI=1S/C13H17N3O3S.ClH/c1-18-5-4-14-8-12(17)15-7-10-9-19-13(16-10)11-3-2-6-20-11;/h2-3,6,9,14H,4-5,7-8H2,1H3,(H,15,17);1H |
| InChIKey | CIOGPMDEOYMIEE-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 76.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.82 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|