C15H20ClN3O3 — CID 119782299
2-(2-methoxyethylamino)-N-[(2-phenyl-1,3-oxazol-4-yl)methyl]acetamide;hydrochloride (PubChem CID 119782299) has the molecular formula C15H20ClN3O3 and a molecular weight of 325.80 g/mol. Its IUPAC name is 2-(2-methoxyethylamino)-N-[(2-phenyl-1,3-oxazol-4-yl)methyl]acetamide;hydrochloride.
| Compound Name | 2-(2-methoxyethylamino)-N-[(2-phenyl-1,3-oxazol-4-yl)methyl]acetamide;hydrochloride |
|---|---|
| PubChem CID | 119782299 |
| Molecular Formula | C15H20ClN3O3 |
| Molecular Weight | 325.80 g/mol |
| Exact Mass | 325.12 |
| IUPAC Name | 2-(2-methoxyethylamino)-N-[(2-phenyl-1,3-oxazol-4-yl)methyl]acetamide;hydrochloride |
| SMILES | COCCNCC(=O)NCc1coc(-c2ccccc2)n1.Cl |
| InChI | InChI=1S/C15H19N3O3.ClH/c1-20-8-7-16-10-14(19)17-9-13-11-21-15(18-13)12-5-3-2-4-6-12;/h2-6,11,16H,7-10H2,1H3,(H,17,19);1H |
| InChIKey | RDQZSOOLHUMNJU-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 76.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.80 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|