C10H16N2O3 — CID 3229603
N-(furan-2-ylmethyl)-2-(2-methoxyethylamino)acetamide (PubChem CID 3229603) has the molecular formula C10H16N2O3 and a molecular weight of 212.25 g/mol. Its IUPAC name is N-(furan-2-ylmethyl)-2-(2-methoxyethylamino)acetamide.
| Compound Name | N-(furan-2-ylmethyl)-2-(2-methoxyethylamino)acetamide |
|---|---|
| PubChem CID | 3229603 |
| Molecular Formula | C10H16N2O3 |
| Molecular Weight | 212.25 g/mol |
| Exact Mass | 212.12 |
| IUPAC Name | N-(furan-2-ylmethyl)-2-(2-methoxyethylamino)acetamide |
| SMILES | COCCNCC(=O)NCc1ccco1 |
| InChI | InChI=1S/C10H16N2O3/c1-14-6-4-11-8-10(13)12-7-9-3-2-5-15-9/h2-3,5,11H,4,6-8H2,1H3,(H,12,13) |
| InChIKey | AMJVEEVCNIWXJX-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 63.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.25 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|