C17H22ClN3O4 — CID 119700864
N-[4-[[[2-(2-methoxyethylamino)acetyl]amino]methyl]phenyl]furan-2-carboxamide;hydrochloride (PubChem CID 119700864) has the molecular formula C17H22ClN3O4 and a molecular weight of 367.83 g/mol. Its IUPAC name is N-[4-[[[2-(2-methoxyethylamino)acetyl]amino]methyl]phenyl]furan-2-carboxamide;hydrochloride.
| Compound Name | N-[4-[[[2-(2-methoxyethylamino)acetyl]amino]methyl]phenyl]furan-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119700864 |
| Molecular Formula | C17H22ClN3O4 |
| Molecular Weight | 367.83 g/mol |
| Exact Mass | 367.13 |
| IUPAC Name | N-[4-[[[2-(2-methoxyethylamino)acetyl]amino]methyl]phenyl]furan-2-carboxamide;hydrochloride |
| SMILES | COCCNCC(=O)NCc1ccc(NC(=O)c2ccco2)cc1.Cl |
| InChI | InChI=1S/C17H21N3O4.ClH/c1-23-10-8-18-12-16(21)19-11-13-4-6-14(7-5-13)20-17(22)15-3-2-9-24-15;/h2-7,9,18H,8,10-12H2,1H3,(H,19,21)(H,20,22);1H |
| InChIKey | IGVMPKSLBGANNQ-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 92.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.83 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|