C13H21ClN2O4S — CID 119706515
2-(2-methoxyethylamino)-N-[(4-methylsulfonylphenyl)methyl]acetamide;hydrochloride (PubChem CID 119706515) has the molecular formula C13H21ClN2O4S and a molecular weight of 336.84 g/mol. Its IUPAC name is 2-(2-methoxyethylamino)-N-[(4-methylsulfonylphenyl)methyl]acetamide;hydrochloride.
| Compound Name | 2-(2-methoxyethylamino)-N-[(4-methylsulfonylphenyl)methyl]acetamide;hydrochloride |
|---|---|
| PubChem CID | 119706515 |
| Molecular Formula | C13H21ClN2O4S |
| Molecular Weight | 336.84 g/mol |
| Exact Mass | 336.09 |
| IUPAC Name | 2-(2-methoxyethylamino)-N-[(4-methylsulfonylphenyl)methyl]acetamide;hydrochloride |
| SMILES | COCCNCC(=O)NCc1ccc(S(C)(=O)=O)cc1.Cl |
| InChI | InChI=1S/C13H20N2O4S.ClH/c1-19-8-7-14-10-13(16)15-9-11-3-5-12(6-4-11)20(2,17)18;/h3-6,14H,7-10H2,1-2H3,(H,15,16);1H |
| InChIKey | HIJWDUGLTCLWNF-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.84 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|